C28H24N10O7S2 — CID 147506897
5-amino-3-[(4-aminophenyl)diazenyl]-6-[[4-[(2,4-diaminophenyl)diazenyl]phenyl]diazenyl]-4-hydroxynaphthalene-2,7-disulfonic acid (PubChem CID 147506897) has the molecular formula C28H24N10O7S2 and a molecular weight of 676.70 g/mol. Its IUPAC name is 5-amino-3-[(4-aminophenyl)diazenyl]-6-[[4-[(2,4-diaminophenyl)diazenyl]phenyl]diazenyl]-4-hydroxynaphthalene-2,7-disulfonic acid.
| Compound Name | 5-amino-3-[(4-aminophenyl)diazenyl]-6-[[4-[(2,4-diaminophenyl)diazenyl]phenyl]diazenyl]-4-hydroxynaphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 147506897 |
| Molecular Formula | C28H24N10O7S2 |
| Molecular Weight | 676.70 g/mol |
| Exact Mass | 676.13 |
| IUPAC Name | 5-amino-3-[(4-aminophenyl)diazenyl]-6-[[4-[(2,4-diaminophenyl)diazenyl]phenyl]diazenyl]-4-hydroxynaphthalene-2,7-disulfonic acid |
| SMILES | Nc1ccc(/N=N/c2c(S(=O)(=O)O)cc3cc(S(=O)(=O)O)c(/N=N/c4ccc(/N=N/c5ccc(N)cc5N)cc4)c(N)c3c2O)cc1 |
| InChI | InChI=1S/C28H24N10O7S2/c29-15-1-4-17(5-2-15)35-38-27-23(47(43,44)45)12-14-11-22(46(40,41)42)26(25(32)24(14)28(27)39)37-34-19-8-6-18(7-9-19)33-36-21-10-3-16(30)13-20(21)31/h1-13,39H,29-32H2,(H,40,41,42)(H,43,44,45)/b36-33+,37-34+,38-35+ |
| InChIKey | FIMYWYPVFIITFC-CRKWBCORSA-N |
| XLogP | 6.61 |
| TPSA | 307.21 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.70 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|