C28H24N10O4S — CID 136917429
6-[(2,4-diaminophenyl)diazenyl]-3-[[4-[(2,4-diaminophenyl)diazenyl]phenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonic acid (PubChem CID 136917429) has the molecular formula C28H24N10O4S and a molecular weight of 596.63 g/mol. Its IUPAC name is 6-[(2,4-diaminophenyl)diazenyl]-3-[[4-[(2,4-diaminophenyl)diazenyl]phenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonic acid.
| Compound Name | 6-[(2,4-diaminophenyl)diazenyl]-3-[[4-[(2,4-diaminophenyl)diazenyl]phenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 136917429 |
| Molecular Formula | C28H24N10O4S |
| Molecular Weight | 596.63 g/mol |
| Exact Mass | 596.17 |
| IUPAC Name | 6-[(2,4-diaminophenyl)diazenyl]-3-[[4-[(2,4-diaminophenyl)diazenyl]phenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonic acid |
| SMILES | Nc1ccc(/N=N/c2ccc(/N=N/c3c(S(=O)(=O)O)cc4ccc(/N=N/c5ccc(N)cc5N)cc4c3O)cc2)c(N)c1 |
| InChI | InChI=1S/C28H24N10O4S/c29-16-2-9-24(22(31)12-16)36-33-18-5-7-19(8-6-18)34-38-27-26(43(40,41)42)11-15-1-4-20(14-21(15)28(27)39)35-37-25-10-3-17(30)13-23(25)32/h1-14,39H,29-32H2,(H,40,41,42)/b36-33+,37-35+,38-34+ |
| InChIKey | KCJASOPCWJVZAQ-MIYISRMYSA-N |
| XLogP | 7.37 |
| TPSA | 252.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.63 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|