C34H27N9O10S3 — CID 136735994
6-amino-3-[[4-[4-[[2,4-diamino-5-[(4-sulfophenyl)diazenyl]phenyl]diazenyl]phenyl]-2-sulfophenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonic acid (PubChem CID 136735994) has the molecular formula C34H27N9O10S3 and a molecular weight of 817.84 g/mol. Its IUPAC name is 6-amino-3-[[4-[4-[[2,4-diamino-5-[(4-sulfophenyl)diazenyl]phenyl]diazenyl]phenyl]-2-sulfophenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonic acid.
| Compound Name | 6-amino-3-[[4-[4-[[2,4-diamino-5-[(4-sulfophenyl)diazenyl]phenyl]diazenyl]phenyl]-2-sulfophenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 136735994 |
| Molecular Formula | C34H27N9O10S3 |
| Molecular Weight | 817.84 g/mol |
| Exact Mass | 817.10 |
| IUPAC Name | 6-amino-3-[[4-[4-[[2,4-diamino-5-[(4-sulfophenyl)diazenyl]phenyl]diazenyl]phenyl]-2-sulfophenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonic acid |
| SMILES | Nc1ccc2cc(S(=O)(=O)O)c(/N=N/c3ccc(-c4ccc(/N=N/c5cc(/N=N/c6ccc(S(=O)(=O)O)cc6)c(N)cc5N)cc4)cc3S(=O)(=O)O)c(O)c2c1 |
| InChI | InChI=1S/C34H27N9O10S3/c35-21-5-1-20-14-32(56(51,52)53)33(34(44)25(20)15-21)43-40-28-12-4-19(13-31(28)55(48,49)50)18-2-6-22(7-3-18)38-41-29-17-30(27(37)16-26(29)36)42-39-23-8-10-24(11-9-23)54(45,46)47/h1-17,44H,35-37H2,(H,45,46,47)(H,48,49,50)(H,51,52,53)/b41-38+,42-39+,43-40+ |
| InChIKey | MHVDELVXMIZFMG-AIPHFEBLSA-N |
| XLogP | 7.95 |
| TPSA | 335.56 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 56 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.84 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|