C34H28N6NaO9S2+ — CID 135421948
sodium 6-amino-3-[[4-[4-[(7-amino-1-hydroxy-3-sulfonaphthalen-2-yl)diazenyl]-3-ethoxyphenyl]phenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonic acid (PubChem CID 135421948) has the molecular formula C34H28N6NaO9S2+ and a molecular weight of 751.75 g/mol. Its IUPAC name is sodium 6-amino-3-[[4-[4-[(7-amino-1-hydroxy-3-sulfonaphthalen-2-yl)diazenyl]-3-ethoxyphenyl]phenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonic acid.
| Compound Name | sodium 6-amino-3-[[4-[4-[(7-amino-1-hydroxy-3-sulfonaphthalen-2-yl)diazenyl]-3-ethoxyphenyl]phenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 135421948 |
| Molecular Formula | C34H28N6NaO9S2+ |
| Molecular Weight | 751.75 g/mol |
| Exact Mass | 751.13 |
| IUPAC Name | sodium 6-amino-3-[[4-[4-[(7-amino-1-hydroxy-3-sulfonaphthalen-2-yl)diazenyl]-3-ethoxyphenyl]phenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonic acid |
| SMILES | CCOc1cc(-c2ccc(/N=N/c3c(S(=O)(=O)O)cc4ccc(N)cc4c3O)cc2)ccc1/N=N/c1c(S(=O)(=O)O)cc2ccc(N)cc2c1O.[Na+] |
| InChI | InChI=1S/C34H28N6O9S2.Na/c1-2-49-28-13-19(7-12-27(28)38-40-32-30(51(46,47)48)15-21-4-9-23(36)17-26(21)34(32)42)18-5-10-24(11-6-18)37-39-31-29(50(43,44)45)14-20-3-8-22(35)16-25(20)33(31)41;/h3-17,41-42H,2,35-36H2,1H3,(H,43,44,45)(H,46,47,48);/q;+1/b39-37+,40-38+; |
| InChIKey | XWWGHZAJSLZQJY-IJKDMPGWSA-N |
| XLogP | 4.96 |
| TPSA | 259.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.75 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|