C34H26N4O12S3 — CID 136714849
4-[[4-[3-ethoxy-4-[(1-hydroxy-4-sulfonaphthalen-2-yl)diazenyl]phenyl]phenyl]diazenyl]-3-hydroxynaphthalene-2,6-disulfonic acid (PubChem CID 136714849) has the molecular formula C34H26N4O12S3 and a molecular weight of 778.80 g/mol. Its IUPAC name is 4-[[4-[3-ethoxy-4-[(1-hydroxy-4-sulfonaphthalen-2-yl)diazenyl]phenyl]phenyl]diazenyl]-3-hydroxynaphthalene-2,6-disulfonic acid.
| Compound Name | 4-[[4-[3-ethoxy-4-[(1-hydroxy-4-sulfonaphthalen-2-yl)diazenyl]phenyl]phenyl]diazenyl]-3-hydroxynaphthalene-2,6-disulfonic acid |
|---|---|
| PubChem CID | 136714849 |
| Molecular Formula | C34H26N4O12S3 |
| Molecular Weight | 778.80 g/mol |
| Exact Mass | 778.07 |
| IUPAC Name | 4-[[4-[3-ethoxy-4-[(1-hydroxy-4-sulfonaphthalen-2-yl)diazenyl]phenyl]phenyl]diazenyl]-3-hydroxynaphthalene-2,6-disulfonic acid |
| SMILES | CCOc1cc(-c2ccc(/N=N/c3c(O)c(S(=O)(=O)O)cc4ccc(S(=O)(=O)O)cc34)cc2)ccc1/N=N/c1cc(S(=O)(=O)O)c2ccccc2c1O |
| InChI | InChI=1S/C34H26N4O12S3/c1-2-50-29-15-20(10-14-27(29)36-37-28-18-30(52(44,45)46)24-5-3-4-6-25(24)33(28)39)19-7-11-22(12-8-19)35-38-32-26-17-23(51(41,42)43)13-9-21(26)16-31(34(32)40)53(47,48)49/h3-18,39-40H,2H2,1H3,(H,41,42,43)(H,44,45,46)(H,47,48,49)/b37-36+,38-35+ |
| InChIKey | FAGTUYSSDXAWJH-UIEKNABSSA-N |
| XLogP | 8.04 |
| TPSA | 262.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.80 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|