C34H23F3N4O9S2 — CID 157303316
4-hydroxy-3-[[4-[4-[(1-hydroxy-4-sulfonaphthalen-2-yl)diazenyl]-3-(trifluoromethoxy)phenyl]-2-methylphenyl]diazenyl]naphthalene-1-sulfonic acid (PubChem CID 157303316) has the molecular formula C34H23F3N4O9S2 and a molecular weight of 752.71 g/mol. Its IUPAC name is 4-hydroxy-3-[[4-[4-[(1-hydroxy-4-sulfonaphthalen-2-yl)diazenyl]-3-(trifluoromethoxy)phenyl]-2-methylphenyl]diazenyl]naphthalene-1-sulfonic acid.
| Compound Name | 4-hydroxy-3-[[4-[4-[(1-hydroxy-4-sulfonaphthalen-2-yl)diazenyl]-3-(trifluoromethoxy)phenyl]-2-methylphenyl]diazenyl]naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 157303316 |
| Molecular Formula | C34H23F3N4O9S2 |
| Molecular Weight | 752.71 g/mol |
| Exact Mass | 752.09 |
| IUPAC Name | 4-hydroxy-3-[[4-[4-[(1-hydroxy-4-sulfonaphthalen-2-yl)diazenyl]-3-(trifluoromethoxy)phenyl]-2-methylphenyl]diazenyl]naphthalene-1-sulfonic acid |
| SMILES | Cc1cc(-c2ccc(/N=N/c3cc(S(=O)(=O)O)c4ccccc4c3O)c(OC(F)(F)F)c2)ccc1/N=N/c1cc(S(=O)(=O)O)c2ccccc2c1O |
| InChI | InChI=1S/C34H23F3N4O9S2/c1-18-14-19(10-12-25(18)38-40-27-16-30(51(44,45)46)21-6-2-4-8-23(21)32(27)42)20-11-13-26(29(15-20)50-34(35,36)37)39-41-28-17-31(52(47,48)49)22-7-3-5-9-24(22)33(28)43/h2-17,42-43H,1H3,(H,44,45,46)(H,47,48,49)/b40-38+,41-39+ |
| InChIKey | BCDSJSSPHNUINB-QYGUTFKISA-N |
| XLogP | 9.60 |
| TPSA | 207.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.71 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|