C26H19N5O4S — CID 136714819
3-[[4-[(4-aminonaphthalen-1-yl)diazenyl]phenyl]diazenyl]-4-hydroxynaphthalene-1-sulfonic acid (PubChem CID 136714819) has the molecular formula C26H19N5O4S and a molecular weight of 497.54 g/mol. Its IUPAC name is 3-[[4-[(4-aminonaphthalen-1-yl)diazenyl]phenyl]diazenyl]-4-hydroxynaphthalene-1-sulfonic acid.
| Compound Name | 3-[[4-[(4-aminonaphthalen-1-yl)diazenyl]phenyl]diazenyl]-4-hydroxynaphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 136714819 |
| Molecular Formula | C26H19N5O4S |
| Molecular Weight | 497.54 g/mol |
| Exact Mass | 497.12 |
| IUPAC Name | 3-[[4-[(4-aminonaphthalen-1-yl)diazenyl]phenyl]diazenyl]-4-hydroxynaphthalene-1-sulfonic acid |
| SMILES | Nc1ccc(/N=N/c2ccc(/N=N/c3cc(S(=O)(=O)O)c4ccccc4c3O)cc2)c2ccccc12 |
| InChI | InChI=1S/C26H19N5O4S/c27-22-13-14-23(19-6-2-1-5-18(19)22)30-28-16-9-11-17(12-10-16)29-31-24-15-25(36(33,34)35)20-7-3-4-8-21(20)26(24)32/h1-15,32H,27H2,(H,33,34,35)/b30-28+,31-29+ |
| InChIKey | FTJUUOZMOLEZMW-FUEWEDNTSA-N |
| XLogP | 7.36 |
| TPSA | 150.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.54 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|