C34H26N6O3S — CID 123942651
5-[(4-aminonaphthalen-1-yl)diazenyl]-2-[2-[4-[(4-aminonaphthalen-1-yl)diazenyl]phenyl]ethenyl]benzenesulfonic acid (PubChem CID 123942651) has the molecular formula C34H26N6O3S and a molecular weight of 598.69 g/mol. Its IUPAC name is 5-[(4-aminonaphthalen-1-yl)diazenyl]-2-[2-[4-[(4-aminonaphthalen-1-yl)diazenyl]phenyl]ethenyl]benzenesulfonic acid.
| Compound Name | 5-[(4-aminonaphthalen-1-yl)diazenyl]-2-[2-[4-[(4-aminonaphthalen-1-yl)diazenyl]phenyl]ethenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 123942651 |
| Molecular Formula | C34H26N6O3S |
| Molecular Weight | 598.69 g/mol |
| Exact Mass | 598.18 |
| IUPAC Name | 5-[(4-aminonaphthalen-1-yl)diazenyl]-2-[2-[4-[(4-aminonaphthalen-1-yl)diazenyl]phenyl]ethenyl]benzenesulfonic acid |
| SMILES | Nc1ccc(/N=N/c2ccc(C=Cc3ccc(/N=N/c4ccc(N)c5ccccc45)cc3S(=O)(=O)O)cc2)c2ccccc12 |
| InChI | InChI=1S/C34H26N6O3S/c35-30-17-19-32(28-7-3-1-5-26(28)30)39-37-24-14-10-22(11-15-24)9-12-23-13-16-25(21-34(23)44(41,42)43)38-40-33-20-18-31(36)27-6-2-4-8-29(27)33/h1-21H,35-36H2,(H,41,42,43)/b12-9?,39-37+,40-38+ |
| InChIKey | IBQRLCGDJRKFPP-SRBAWZCISA-N |
| XLogP | 9.41 |
| TPSA | 155.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.69 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|