C24H19N3O6S2 — CID 172835508
2-[(4-aminonaphthalen-1-yl)diazenyl]-6-[2-(2-sulfophenyl)ethenyl]benzenesulfonic acid (PubChem CID 172835508) has the molecular formula C24H19N3O6S2 and a molecular weight of 509.57 g/mol. Its IUPAC name is 2-[(4-aminonaphthalen-1-yl)diazenyl]-6-[2-(2-sulfophenyl)ethenyl]benzenesulfonic acid.
| Compound Name | 2-[(4-aminonaphthalen-1-yl)diazenyl]-6-[2-(2-sulfophenyl)ethenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 172835508 |
| Molecular Formula | C24H19N3O6S2 |
| Molecular Weight | 509.57 g/mol |
| Exact Mass | 509.07 |
| IUPAC Name | 2-[(4-aminonaphthalen-1-yl)diazenyl]-6-[2-(2-sulfophenyl)ethenyl]benzenesulfonic acid |
| SMILES | Nc1ccc(/N=N/c2cccc(C=Cc3ccccc3S(=O)(=O)O)c2S(=O)(=O)O)c2ccccc12 |
| InChI | InChI=1S/C24H19N3O6S2/c25-20-14-15-21(19-9-3-2-8-18(19)20)26-27-22-10-5-7-17(24(22)35(31,32)33)13-12-16-6-1-4-11-23(16)34(28,29)30/h1-15H,25H2,(H,28,29,30)(H,31,32,33)/b13-12?,27-26+ |
| InChIKey | WCDYYKUWWKCPNO-MUMCGWFVSA-N |
| XLogP | 5.50 |
| TPSA | 159.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.57 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|