C34H24N4NaO8S2+ — CID 135421920
sodium 5-[(4-hydroxynaphthalen-1-yl)diazenyl]-2-[(E)-2-[4-[(4-hydroxynaphthalen-1-yl)diazenyl]-2-sulfophenyl]ethenyl]benzenesulfonic acid (PubChem CID 135421920) has the molecular formula C34H24N4NaO8S2+ and a molecular weight of 703.71 g/mol. Its IUPAC name is sodium 5-[(4-hydroxynaphthalen-1-yl)diazenyl]-2-[(E)-2-[4-[(4-hydroxynaphthalen-1-yl)diazenyl]-2-sulfophenyl]ethenyl]benzenesulfonic acid.
| Compound Name | sodium 5-[(4-hydroxynaphthalen-1-yl)diazenyl]-2-[(E)-2-[4-[(4-hydroxynaphthalen-1-yl)diazenyl]-2-sulfophenyl]ethenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 135421920 |
| Molecular Formula | C34H24N4NaO8S2+ |
| Molecular Weight | 703.71 g/mol |
| Exact Mass | 703.09 |
| IUPAC Name | sodium 5-[(4-hydroxynaphthalen-1-yl)diazenyl]-2-[(E)-2-[4-[(4-hydroxynaphthalen-1-yl)diazenyl]-2-sulfophenyl]ethenyl]benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1cc(/N=N/c2ccc(O)c3ccccc23)ccc1/C=C/c1ccc(/N=N/c2ccc(O)c3ccccc23)cc1S(=O)(=O)O.[Na+] |
| InChI | InChI=1S/C34H24N4O8S2.Na/c39-31-17-15-29(25-5-1-3-7-27(25)31)37-35-23-13-11-21(33(19-23)47(41,42)43)9-10-22-12-14-24(20-34(22)48(44,45)46)36-38-30-16-18-32(40)28-8-4-2-6-26(28)30;/h1-20,39-40H,(H,41,42,43)(H,44,45,46);/q;+1/b10-9+,37-35+,38-36+; |
| InChIKey | QBCQAEUCJPKCNI-LKYYKZJNSA-N |
| XLogP | 5.90 |
| TPSA | 198.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.71 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|