C26H20N4O10S2 — CID 135422240
5-[(2,4-dihydroxyphenyl)diazenyl]-2-[(E)-2-[4-[(2,4-dihydroxyphenyl)diazenyl]-2-sulfophenyl]ethenyl]benzenesulfonic acid (PubChem CID 135422240) has the molecular formula C26H20N4O10S2 and a molecular weight of 612.60 g/mol. Its IUPAC name is 5-[(2,4-dihydroxyphenyl)diazenyl]-2-[(E)-2-[4-[(2,4-dihydroxyphenyl)diazenyl]-2-sulfophenyl]ethenyl]benzenesulfonic acid.
| Compound Name | 5-[(2,4-dihydroxyphenyl)diazenyl]-2-[(E)-2-[4-[(2,4-dihydroxyphenyl)diazenyl]-2-sulfophenyl]ethenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 135422240 |
| Molecular Formula | C26H20N4O10S2 |
| Molecular Weight | 612.60 g/mol |
| Exact Mass | 612.06 |
| IUPAC Name | 5-[(2,4-dihydroxyphenyl)diazenyl]-2-[(E)-2-[4-[(2,4-dihydroxyphenyl)diazenyl]-2-sulfophenyl]ethenyl]benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1cc(/N=N/c2ccc(O)cc2O)ccc1/C=C/c1ccc(/N=N/c2ccc(O)cc2O)cc1S(=O)(=O)O |
| InChI | InChI=1S/C26H20N4O10S2/c31-19-7-9-21(23(33)13-19)29-27-17-5-3-15(25(11-17)41(35,36)37)1-2-16-4-6-18(12-26(16)42(38,39)40)28-30-22-10-8-20(32)14-24(22)34/h1-14,31-34H,(H,35,36,37)(H,38,39,40)/b2-1+,29-27+,30-28+ |
| InChIKey | GLVLQKSQNZQNGF-YGCIHOFZSA-N |
| XLogP | 6.00 |
| TPSA | 239.10 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.60 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|