C12H9N2O5S- — CID 3343252
4-[(2,4-dihydroxyphenyl)diazenyl]benzenesulfonate (PubChem CID 3343252) has the molecular formula C12H9N2O5S- and a molecular weight of 293.28 g/mol. Its IUPAC name is 4-[(2,4-dihydroxyphenyl)diazenyl]benzenesulfonate.
| Compound Name | 4-[(2,4-dihydroxyphenyl)diazenyl]benzenesulfonate |
|---|---|
| PubChem CID | 3343252 |
| Molecular Formula | C12H9N2O5S- |
| Molecular Weight | 293.28 g/mol |
| Exact Mass | 293.02 |
| IUPAC Name | 4-[(2,4-dihydroxyphenyl)diazenyl]benzenesulfonate |
| SMILES | O=S(=O)([O-])c1ccc(/N=N/c2ccc(O)cc2O)cc1 |
| InChI | InChI=1S/C12H10N2O5S/c15-9-3-6-11(12(16)7-9)14-13-8-1-4-10(5-2-8)20(17,18)19/h1-7,15-16H,(H,17,18,19)/p-1/b14-13+ |
| InChIKey | MHKGJUOEEHNBLE-BUHFOSPRSA-M |
| XLogP | 2.42 |
| TPSA | 122.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.28 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|