C18H14N4O6S — CID 136679511
4-[[2,4-dihydroxy-5-[(4-hydroxyphenyl)diazenyl]phenyl]diazenyl]benzenesulfonic acid (PubChem CID 136679511) has the molecular formula C18H14N4O6S and a molecular weight of 414.40 g/mol. Its IUPAC name is 4-[[2,4-dihydroxy-5-[(4-hydroxyphenyl)diazenyl]phenyl]diazenyl]benzenesulfonic acid.
| Compound Name | 4-[[2,4-dihydroxy-5-[(4-hydroxyphenyl)diazenyl]phenyl]diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 136679511 |
| Molecular Formula | C18H14N4O6S |
| Molecular Weight | 414.40 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | 4-[[2,4-dihydroxy-5-[(4-hydroxyphenyl)diazenyl]phenyl]diazenyl]benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(/N=N/c2cc(/N=N/c3ccc(O)cc3)c(O)cc2O)cc1 |
| InChI | InChI=1S/C18H14N4O6S/c23-13-5-1-11(2-6-13)19-21-15-9-16(18(25)10-17(15)24)22-20-12-3-7-14(8-4-12)29(26,27)28/h1-10,23-25H,(H,26,27,28)/b21-19+,22-20+ |
| InChIKey | VBVVVLJBGZXCIM-FLFKKZLDSA-N |
| XLogP | 4.88 |
| TPSA | 164.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.40 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|