C12H9FN2O4S — CID 136728610
4-[(5-fluoro-2-hydroxyphenyl)diazenyl]benzenesulfonic acid (PubChem CID 136728610) has the molecular formula C12H9FN2O4S and a molecular weight of 296.28 g/mol. Its IUPAC name is 4-[(5-fluoro-2-hydroxyphenyl)diazenyl]benzenesulfonic acid.
| Compound Name | 4-[(5-fluoro-2-hydroxyphenyl)diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 136728610 |
| Molecular Formula | C12H9FN2O4S |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.03 |
| IUPAC Name | 4-[(5-fluoro-2-hydroxyphenyl)diazenyl]benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(/N=N/c2cc(F)ccc2O)cc1 |
| InChI | InChI=1S/C12H9FN2O4S/c13-8-1-6-12(16)11(7-8)15-14-9-2-4-10(5-3-9)20(17,18)19/h1-7,16H,(H,17,18,19)/b15-14+ |
| InChIKey | DAENCNVPQNOQSB-CCEZHUSRSA-N |
| XLogP | 3.19 |
| TPSA | 99.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|