C13H10N2NaO5S — CID 137190326
CID 137190326 (PubChem CID 137190326) has the molecular formula C13H10N2NaO5S and a molecular weight of 329.29 g/mol.
| Compound Name | CID 137190326 |
|---|---|
| PubChem CID | 137190326 |
| Molecular Formula | C13H10N2NaO5S |
| Molecular Weight | 329.29 g/mol |
| Exact Mass | 329.02 |
| IUPAC Name | — |
| SMILES | O=Cc1cc(/N=N/c2ccc(S(=O)(=O)O)cc2)ccc1O.[Na] |
| InChI | InChI=1S/C13H10N2O5S.Na/c16-8-9-7-11(3-6-13(9)17)15-14-10-1-4-12(5-2-10)21(18,19)20;/h1-8,17H,(H,18,19,20);/b15-14+; |
| InChIKey | HRLQUYYTYJDAGK-WPDLWGESSA-N |
| XLogP | 2.49 |
| TPSA | 116.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.29 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|