C25H20N8O6S — CID 136917462
5-[[4-[[2,4-diamino-5-[(4-sulfophenyl)diazenyl]phenyl]diazenyl]phenyl]diazenyl]-2-hydroxybenzoic acid (PubChem CID 136917462) has the molecular formula C25H20N8O6S and a molecular weight of 560.55 g/mol. Its IUPAC name is 5-[[4-[[2,4-diamino-5-[(4-sulfophenyl)diazenyl]phenyl]diazenyl]phenyl]diazenyl]-2-hydroxybenzoic acid.
| Compound Name | 5-[[4-[[2,4-diamino-5-[(4-sulfophenyl)diazenyl]phenyl]diazenyl]phenyl]diazenyl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 136917462 |
| Molecular Formula | C25H20N8O6S |
| Molecular Weight | 560.55 g/mol |
| Exact Mass | 560.12 |
| IUPAC Name | 5-[[4-[[2,4-diamino-5-[(4-sulfophenyl)diazenyl]phenyl]diazenyl]phenyl]diazenyl]-2-hydroxybenzoic acid |
| SMILES | Nc1cc(N)c(/N=N/c2ccc(S(=O)(=O)O)cc2)cc1/N=N/c1ccc(/N=N/c2ccc(O)c(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C25H20N8O6S/c26-20-12-21(27)23(33-30-16-5-8-18(9-6-16)40(37,38)39)13-22(20)32-29-15-3-1-14(2-4-15)28-31-17-7-10-24(34)19(11-17)25(35)36/h1-13,34H,26-27H2,(H,35,36)(H,37,38,39)/b31-28+,32-29+,33-30+ |
| InChIKey | QNWGOOSQFMNLAX-MSMGOPBLSA-N |
| XLogP | 6.75 |
| TPSA | 238.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.55 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|