C31H22N6Na2O8S — CID 137177090
CID 137177090 (PubChem CID 137177090) has the molecular formula C31H22N6Na2O8S and a molecular weight of 684.60 g/mol.
| Compound Name | CID 137177090 |
|---|---|
| PubChem CID | 137177090 |
| Molecular Formula | C31H22N6Na2O8S |
| Molecular Weight | 684.60 g/mol |
| Exact Mass | 684.10 |
| IUPAC Name | — |
| SMILES | O=C(O)c1cc(/N=N/c2ccc(-c3ccc(/N=N/c4ccc(O)c(/N=N/c5ccc(S(=O)(=O)O)cc5)c4O)cc3)cc2)ccc1O.[Na].[Na] |
| InChI | InChI=1S/C31H22N6O8S.2Na/c38-27-15-11-23(17-25(27)31(41)42)35-32-20-5-1-18(2-6-20)19-3-7-21(8-4-19)33-36-26-14-16-28(39)29(30(26)40)37-34-22-9-12-24(13-10-22)46(43,44)45;;/h1-17,38-40H,(H,41,42)(H,43,44,45);;/b35-32+,36-33+,37-34+;; |
| InChIKey | BGAFVEAFKWJXJF-ITNIHSDHSA-N |
| XLogP | 7.90 |
| TPSA | 226.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.60 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|