C35H25N7O7S — CID 136917449
5-[[4-[4-[(8-amino-1-hydroxy-7-phenyldiazenyl-5-sulfonaphthalen-2-yl)diazenyl]phenyl]phenyl]diazenyl]-2-hydroxybenzoic acid (PubChem CID 136917449) has the molecular formula C35H25N7O7S and a molecular weight of 687.69 g/mol. Its IUPAC name is 5-[[4-[4-[(8-amino-1-hydroxy-7-phenyldiazenyl-5-sulfonaphthalen-2-yl)diazenyl]phenyl]phenyl]diazenyl]-2-hydroxybenzoic acid.
| Compound Name | 5-[[4-[4-[(8-amino-1-hydroxy-7-phenyldiazenyl-5-sulfonaphthalen-2-yl)diazenyl]phenyl]phenyl]diazenyl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 136917449 |
| Molecular Formula | C35H25N7O7S |
| Molecular Weight | 687.69 g/mol |
| Exact Mass | 687.15 |
| IUPAC Name | 5-[[4-[4-[(8-amino-1-hydroxy-7-phenyldiazenyl-5-sulfonaphthalen-2-yl)diazenyl]phenyl]phenyl]diazenyl]-2-hydroxybenzoic acid |
| SMILES | Nc1c(/N=N/c2ccccc2)cc(S(=O)(=O)O)c2ccc(/N=N/c3ccc(-c4ccc(/N=N/c5ccc(O)c(C(=O)O)c5)cc4)cc3)c(O)c12 |
| InChI | InChI=1S/C35H25N7O7S/c36-33-29(42-38-22-4-2-1-3-5-22)19-31(50(47,48)49)26-15-16-28(34(44)32(26)33)41-39-24-12-8-21(9-13-24)20-6-10-23(11-7-20)37-40-25-14-17-30(43)27(18-25)35(45)46/h1-19,43-44H,36H2,(H,45,46)(H,47,48,49)/b40-37+,41-39+,42-38+ |
| InChIKey | XJVHNDKZRXZSGS-FZNYSNJJSA-N |
| XLogP | 9.69 |
| TPSA | 232.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.69 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|