C30H23N5O6S — CID 136714793
5-[[4-[4-[(1-amino-4-sulfonaphthalen-2-yl)diazenyl]phenyl]phenyl]diazenyl]-2-hydroxy-3-methylbenzoic acid (PubChem CID 136714793) has the molecular formula C30H23N5O6S and a molecular weight of 581.61 g/mol. Its IUPAC name is 5-[[4-[4-[(1-amino-4-sulfonaphthalen-2-yl)diazenyl]phenyl]phenyl]diazenyl]-2-hydroxy-3-methylbenzoic acid.
| Compound Name | 5-[[4-[4-[(1-amino-4-sulfonaphthalen-2-yl)diazenyl]phenyl]phenyl]diazenyl]-2-hydroxy-3-methylbenzoic acid |
|---|---|
| PubChem CID | 136714793 |
| Molecular Formula | C30H23N5O6S |
| Molecular Weight | 581.61 g/mol |
| Exact Mass | 581.14 |
| IUPAC Name | 5-[[4-[4-[(1-amino-4-sulfonaphthalen-2-yl)diazenyl]phenyl]phenyl]diazenyl]-2-hydroxy-3-methylbenzoic acid |
| SMILES | Cc1cc(/N=N/c2ccc(-c3ccc(/N=N/c4cc(S(=O)(=O)O)c5ccccc5c4N)cc3)cc2)cc(C(=O)O)c1O |
| InChI | InChI=1S/C30H23N5O6S/c1-17-14-22(15-25(29(17)36)30(37)38)34-32-20-10-6-18(7-11-20)19-8-12-21(13-9-19)33-35-26-16-27(42(39,40)41)23-4-2-3-5-24(23)28(26)31/h2-16,36H,31H2,1H3,(H,37,38)(H,39,40,41)/b34-32+,35-33+ |
| InChIKey | HMOZJXXZTFYRFH-XUXOKTBYSA-N |
| XLogP | 7.88 |
| TPSA | 187.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.61 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|