C44H32N6O8S2 — CID 136694696
4-hydroxy-3-[[4-[4-[[4-[(1-hydroxy-4-sulfonaphthalen-2-yl)diazenyl]naphthalen-1-yl]diazenyl]-3-methylphenyl]-2-methylphenyl]diazenyl]naphthalene-1-sulfonic acid (PubChem CID 136694696) has the molecular formula C44H32N6O8S2 and a molecular weight of 836.91 g/mol. Its IUPAC name is 4-hydroxy-3-[[4-[4-[[4-[(1-hydroxy-4-sulfonaphthalen-2-yl)diazenyl]naphthalen-1-yl]diazenyl]-3-methylphenyl]-2-methylphenyl]diazenyl]naphthalene-1-sulfonic acid.
| Compound Name | 4-hydroxy-3-[[4-[4-[[4-[(1-hydroxy-4-sulfonaphthalen-2-yl)diazenyl]naphthalen-1-yl]diazenyl]-3-methylphenyl]-2-methylphenyl]diazenyl]naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 136694696 |
| Molecular Formula | C44H32N6O8S2 |
| Molecular Weight | 836.91 g/mol |
| Exact Mass | 836.17 |
| IUPAC Name | 4-hydroxy-3-[[4-[4-[[4-[(1-hydroxy-4-sulfonaphthalen-2-yl)diazenyl]naphthalen-1-yl]diazenyl]-3-methylphenyl]-2-methylphenyl]diazenyl]naphthalene-1-sulfonic acid |
| SMILES | Cc1cc(-c2ccc(/N=N/c3ccc(/N=N/c4cc(S(=O)(=O)O)c5ccccc5c4O)c4ccccc34)c(C)c2)ccc1/N=N/c1cc(S(=O)(=O)O)c2ccccc2c1O |
| InChI | InChI=1S/C44H32N6O8S2/c1-25-21-27(28-16-18-36(26(2)22-28)46-49-39-23-41(59(53,54)55)31-11-5-7-13-33(31)43(39)51)15-17-35(25)45-47-37-19-20-38(30-10-4-3-9-29(30)37)48-50-40-24-42(60(56,57)58)32-12-6-8-14-34(32)44(40)52/h3-24,51-52H,1-2H3,(H,53,54,55)(H,56,57,58)/b47-45+,49-46+,50-48+ |
| InChIKey | PAZHVAWJZZULIS-GTYJEUTKSA-N |
| XLogP | 12.58 |
| TPSA | 223.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 836.91 |
| LogP ≤ 5 | 12.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|