C36H28N4O13S4 — CID 165360336
3-[[4-[4-[[4-(benzenesulfonyloxy)phenyl]diazenyl]-5-methyl-2-sulfophenyl]-2-methyl-5-sulfophenyl]diazenyl]-4-hydroxynaphthalene-1-sulfonic acid (PubChem CID 165360336) has the molecular formula C36H28N4O13S4 and a molecular weight of 852.90 g/mol. Its IUPAC name is 3-[[4-[4-[[4-(benzenesulfonyloxy)phenyl]diazenyl]-5-methyl-2-sulfophenyl]-2-methyl-5-sulfophenyl]diazenyl]-4-hydroxynaphthalene-1-sulfonic acid.
| Compound Name | 3-[[4-[4-[[4-(benzenesulfonyloxy)phenyl]diazenyl]-5-methyl-2-sulfophenyl]-2-methyl-5-sulfophenyl]diazenyl]-4-hydroxynaphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 165360336 |
| Molecular Formula | C36H28N4O13S4 |
| Molecular Weight | 852.90 g/mol |
| Exact Mass | 852.05 |
| IUPAC Name | 3-[[4-[4-[[4-(benzenesulfonyloxy)phenyl]diazenyl]-5-methyl-2-sulfophenyl]-2-methyl-5-sulfophenyl]diazenyl]-4-hydroxynaphthalene-1-sulfonic acid |
| SMILES | Cc1cc(-c2cc(C)c(/N=N/c3cc(S(=O)(=O)O)c4ccccc4c3O)cc2S(=O)(=O)O)c(S(=O)(=O)O)cc1/N=N/c1ccc(OS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C36H28N4O13S4/c1-21-16-28(34(55(45,46)47)18-30(21)38-37-23-12-14-24(15-13-23)53-57(51,52)25-8-4-3-5-9-25)29-17-22(2)31(19-35(29)56(48,49)50)39-40-32-20-33(54(42,43)44)26-10-6-7-11-27(26)36(32)41/h3-20,41H,1-2H3,(H,42,43,44)(H,45,46,47)(H,48,49,50)/b38-37+,40-39+ |
| InChIKey | CTHGWDLFAFQGNU-DEPRKFIZSA-N |
| XLogP | 8.17 |
| TPSA | 276.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 852.90 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|