C34H24N4O14S3 — CID 136912199
2-[1,8-dihydroxy-7-[[4-[4-[(1-hydroxy-4-sulfonaphthalen-2-yl)diazenyl]phenyl]phenyl]diazenyl]-4,5-disulfonaphthalen-2-yl]acetic acid (PubChem CID 136912199) has the molecular formula C34H24N4O14S3 and a molecular weight of 808.78 g/mol. Its IUPAC name is 2-[1,8-dihydroxy-7-[[4-[4-[(1-hydroxy-4-sulfonaphthalen-2-yl)diazenyl]phenyl]phenyl]diazenyl]-4,5-disulfonaphthalen-2-yl]acetic acid.
| Compound Name | 2-[1,8-dihydroxy-7-[[4-[4-[(1-hydroxy-4-sulfonaphthalen-2-yl)diazenyl]phenyl]phenyl]diazenyl]-4,5-disulfonaphthalen-2-yl]acetic acid |
|---|---|
| PubChem CID | 136912199 |
| Molecular Formula | C34H24N4O14S3 |
| Molecular Weight | 808.78 g/mol |
| Exact Mass | 808.05 |
| IUPAC Name | 2-[1,8-dihydroxy-7-[[4-[4-[(1-hydroxy-4-sulfonaphthalen-2-yl)diazenyl]phenyl]phenyl]diazenyl]-4,5-disulfonaphthalen-2-yl]acetic acid |
| SMILES | O=C(O)Cc1cc(S(=O)(=O)O)c2c(S(=O)(=O)O)cc(/N=N/c3ccc(-c4ccc(/N=N/c5cc(S(=O)(=O)O)c6ccccc6c5O)cc4)cc3)c(O)c2c1O |
| InChI | InChI=1S/C34H24N4O14S3/c39-29(40)14-19-13-27(54(47,48)49)30-28(55(50,51)52)16-25(34(43)31(30)32(19)41)38-36-21-11-7-18(8-12-21)17-5-9-20(10-6-17)35-37-24-15-26(53(44,45)46)22-3-1-2-4-23(22)33(24)42/h1-13,15-16,41-43H,14H2,(H,39,40)(H,44,45,46)(H,47,48,49)(H,50,51,52)/b37-35+,38-36+ |
| InChIKey | OKRJZIUHMLCGSK-ATXIYDNESA-N |
| XLogP | 6.97 |
| TPSA | 310.54 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 55 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.78 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|