C23H16N4O11S3 — CID 136613898
2-[(1-hydroxy-4-sulfonaphthalen-2-yl)diazenyl]-5-[(5-sulfino-2-sulfophenyl)diazenyl]benzoic acid (PubChem CID 136613898) has the molecular formula C23H16N4O11S3 and a molecular weight of 620.60 g/mol. Its IUPAC name is 2-[(1-hydroxy-4-sulfonaphthalen-2-yl)diazenyl]-5-[(5-sulfino-2-sulfophenyl)diazenyl]benzoic acid.
| Compound Name | 2-[(1-hydroxy-4-sulfonaphthalen-2-yl)diazenyl]-5-[(5-sulfino-2-sulfophenyl)diazenyl]benzoic acid |
|---|---|
| PubChem CID | 136613898 |
| Molecular Formula | C23H16N4O11S3 |
| Molecular Weight | 620.60 g/mol |
| Exact Mass | 620.00 |
| IUPAC Name | 2-[(1-hydroxy-4-sulfonaphthalen-2-yl)diazenyl]-5-[(5-sulfino-2-sulfophenyl)diazenyl]benzoic acid |
| SMILES | O=C(O)c1cc(/N=N/c2cc(S(=O)O)ccc2S(=O)(=O)O)ccc1/N=N/c1cc(S(=O)(=O)O)c2ccccc2c1O |
| InChI | InChI=1S/C23H16N4O11S3/c28-22-15-4-2-1-3-14(15)21(41(36,37)38)11-19(22)27-25-17-7-5-12(9-16(17)23(29)30)24-26-18-10-13(39(31)32)6-8-20(18)40(33,34)35/h1-11,28H,(H,29,30)(H,31,32)(H,33,34,35)(H,36,37,38)/b26-24+,27-25+ |
| InChIKey | UCGSHODWMULDAQ-OWUYFMIJSA-N |
| XLogP | 5.15 |
| TPSA | 253.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.60 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|