C35H24N6NaO8S+ — CID 135422075
sodium 5-[[4-[4-[[2,4-dihydroxy-3-[(4-sulfonaphthalen-1-yl)diazenyl]phenyl]diazenyl]phenyl]phenyl]diazenyl]-2-hydroxybenzoic acid (PubChem CID 135422075) has the molecular formula C35H24N6NaO8S+ and a molecular weight of 711.67 g/mol. Its IUPAC name is sodium 5-[[4-[4-[[2,4-dihydroxy-3-[(4-sulfonaphthalen-1-yl)diazenyl]phenyl]diazenyl]phenyl]phenyl]diazenyl]-2-hydroxybenzoic acid.
| Compound Name | sodium 5-[[4-[4-[[2,4-dihydroxy-3-[(4-sulfonaphthalen-1-yl)diazenyl]phenyl]diazenyl]phenyl]phenyl]diazenyl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 135422075 |
| Molecular Formula | C35H24N6NaO8S+ |
| Molecular Weight | 711.67 g/mol |
| Exact Mass | 711.13 |
| IUPAC Name | sodium 5-[[4-[4-[[2,4-dihydroxy-3-[(4-sulfonaphthalen-1-yl)diazenyl]phenyl]diazenyl]phenyl]phenyl]diazenyl]-2-hydroxybenzoic acid |
| SMILES | O=C(O)c1cc(/N=N/c2ccc(-c3ccc(/N=N/c4ccc(O)c(/N=N/c5ccc(S(=O)(=O)O)c6ccccc56)c4O)cc3)cc2)ccc1O.[Na+] |
| InChI | InChI=1S/C35H24N6O8S.Na/c42-30-16-13-24(19-27(30)35(45)46)38-36-22-9-5-20(6-10-22)21-7-11-23(12-8-21)37-40-29-14-17-31(43)33(34(29)44)41-39-28-15-18-32(50(47,48)49)26-4-2-1-3-25(26)28;/h1-19,42-44H,(H,45,46)(H,47,48,49);/q;+1/b38-36+,40-37+,41-39+; |
| InChIKey | KHSSYBQVSWTNCT-IRQVUCFFSA-N |
| XLogP | 6.82 |
| TPSA | 226.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.67 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|