C39H27N7O10S2 — CID 135565243
5-[[4-[4-[[4-[(7-amino-1-hydroxy-3-sulfonaphthalen-2-yl)diazenyl]-7-sulfonaphthalen-1-yl]diazenyl]phenyl]phenyl]diazenyl]-2-hydroxybenzoic acid (PubChem CID 135565243) has the molecular formula C39H27N7O10S2 and a molecular weight of 817.82 g/mol. Its IUPAC name is 5-[[4-[4-[[4-[(7-amino-1-hydroxy-3-sulfonaphthalen-2-yl)diazenyl]-7-sulfonaphthalen-1-yl]diazenyl]phenyl]phenyl]diazenyl]-2-hydroxybenzoic acid.
| Compound Name | 5-[[4-[4-[[4-[(7-amino-1-hydroxy-3-sulfonaphthalen-2-yl)diazenyl]-7-sulfonaphthalen-1-yl]diazenyl]phenyl]phenyl]diazenyl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 135565243 |
| Molecular Formula | C39H27N7O10S2 |
| Molecular Weight | 817.82 g/mol |
| Exact Mass | 817.13 |
| IUPAC Name | 5-[[4-[4-[[4-[(7-amino-1-hydroxy-3-sulfonaphthalen-2-yl)diazenyl]-7-sulfonaphthalen-1-yl]diazenyl]phenyl]phenyl]diazenyl]-2-hydroxybenzoic acid |
| SMILES | Nc1ccc2cc(S(=O)(=O)O)c(/N=N/c3ccc(/N=N/c4ccc(-c5ccc(/N=N/c6ccc(O)c(C(=O)O)c6)cc5)cc4)c4cc(S(=O)(=O)O)ccc34)c(O)c2c1 |
| InChI | InChI=1S/C39H27N7O10S2/c40-24-6-1-23-17-36(58(54,55)56)37(38(48)30(23)18-24)46-45-33-14-15-34(31-20-28(57(51,52)53)12-13-29(31)33)44-42-26-9-4-22(5-10-26)21-2-7-25(8-3-21)41-43-27-11-16-35(47)32(19-27)39(49)50/h1-20,47-48H,40H2,(H,49,50)(H,51,52,53)(H,54,55,56)/b43-41+,44-42+,46-45+ |
| InChIKey | NHNBEIKCRVJQKQ-BTLCOCTFSA-N |
| XLogP | 10.09 |
| TPSA | 286.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 58 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.82 |
| LogP ≤ 5 | 10.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|