C29H19N5O10S — CID 135827510
5-[[4-[(7-amino-1-hydroxy-3-sulfonaphthalen-2-yl)diazenyl]-6-carboxynaphthalen-1-yl]diazenyl]benzene-1,3-dicarboxylic acid (PubChem CID 135827510) has the molecular formula C29H19N5O10S and a molecular weight of 629.56 g/mol. Its IUPAC name is 5-[[4-[(7-amino-1-hydroxy-3-sulfonaphthalen-2-yl)diazenyl]-6-carboxynaphthalen-1-yl]diazenyl]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[[4-[(7-amino-1-hydroxy-3-sulfonaphthalen-2-yl)diazenyl]-6-carboxynaphthalen-1-yl]diazenyl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 135827510 |
| Molecular Formula | C29H19N5O10S |
| Molecular Weight | 629.56 g/mol |
| Exact Mass | 629.09 |
| IUPAC Name | 5-[[4-[(7-amino-1-hydroxy-3-sulfonaphthalen-2-yl)diazenyl]-6-carboxynaphthalen-1-yl]diazenyl]benzene-1,3-dicarboxylic acid |
| SMILES | Nc1ccc2cc(S(=O)(=O)O)c(/N=N/c3ccc(/N=N/c4cc(C(=O)O)cc(C(=O)O)c4)c4ccc(C(=O)O)cc34)c(O)c2c1 |
| InChI | InChI=1S/C29H19N5O10S/c30-17-3-1-13-11-24(45(42,43)44)25(26(35)20(13)12-17)34-33-23-6-5-22(19-4-2-14(27(36)37)10-21(19)23)32-31-18-8-15(28(38)39)7-16(9-18)29(40)41/h1-12,35H,30H2,(H,36,37)(H,38,39)(H,40,41)(H,42,43,44)/b32-31+,34-33+ |
| InChIKey | KYMPIZBFRFAOAH-HSBKYFPUSA-N |
| XLogP | 6.45 |
| TPSA | 261.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.56 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|