C27H23N5O4S — CID 135968686
7-amino-2-[(7-methyl-4-phenyldiazenylnaphthalen-1-yl)diazenyl]-3-(trihydroxy-λ4-sulfanyl)naphthalen-1-ol (PubChem CID 135968686) has the molecular formula C27H23N5O4S and a molecular weight of 513.58 g/mol. Its IUPAC name is 7-amino-2-[(7-methyl-4-phenyldiazenylnaphthalen-1-yl)diazenyl]-3-(trihydroxy-λ4-sulfanyl)naphthalen-1-ol.
| Compound Name | 7-amino-2-[(7-methyl-4-phenyldiazenylnaphthalen-1-yl)diazenyl]-3-(trihydroxy-λ4-sulfanyl)naphthalen-1-ol |
|---|---|
| PubChem CID | 135968686 |
| Molecular Formula | C27H23N5O4S |
| Molecular Weight | 513.58 g/mol |
| Exact Mass | 513.15 |
| IUPAC Name | 7-amino-2-[(7-methyl-4-phenyldiazenylnaphthalen-1-yl)diazenyl]-3-(trihydroxy-λ4-sulfanyl)naphthalen-1-ol |
| SMILES | Cc1ccc2c(/N=N/c3ccccc3)ccc(/N=N/c3c(S(O)(O)O)cc4ccc(N)cc4c3O)c2c1 |
| InChI | InChI=1S/C27H23N5O4S/c1-16-7-10-20-22(13-16)24(12-11-23(20)30-29-19-5-3-2-4-6-19)31-32-26-25(37(34,35)36)14-17-8-9-18(28)15-21(17)27(26)33/h2-15,33-36H,28H2,1H3/b30-29+,32-31+ |
| InChIKey | GFNGMIRWWOCKIE-PNBBGTCESA-N |
| XLogP | 9.00 |
| TPSA | 156.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.58 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|