C27H19N5O9S2 — CID 136743149
4-[[4-[(7-amino-1-hydroxy-3-sulfonaphthalen-2-yl)diazenyl]-7-sulfonaphthalen-1-yl]diazenyl]benzoic acid (PubChem CID 136743149) has the molecular formula C27H19N5O9S2 and a molecular weight of 621.61 g/mol. Its IUPAC name is 4-[[4-[(7-amino-1-hydroxy-3-sulfonaphthalen-2-yl)diazenyl]-7-sulfonaphthalen-1-yl]diazenyl]benzoic acid.
| Compound Name | 4-[[4-[(7-amino-1-hydroxy-3-sulfonaphthalen-2-yl)diazenyl]-7-sulfonaphthalen-1-yl]diazenyl]benzoic acid |
|---|---|
| PubChem CID | 136743149 |
| Molecular Formula | C27H19N5O9S2 |
| Molecular Weight | 621.61 g/mol |
| Exact Mass | 621.06 |
| IUPAC Name | 4-[[4-[(7-amino-1-hydroxy-3-sulfonaphthalen-2-yl)diazenyl]-7-sulfonaphthalen-1-yl]diazenyl]benzoic acid |
| SMILES | Nc1ccc2cc(S(=O)(=O)O)c(/N=N/c3ccc(/N=N/c4ccc(C(=O)O)cc4)c4cc(S(=O)(=O)O)ccc34)c(O)c2c1 |
| InChI | InChI=1S/C27H19N5O9S2/c28-16-4-1-15-11-24(43(39,40)41)25(26(33)20(15)12-16)32-31-22-9-10-23(21-13-18(42(36,37)38)7-8-19(21)22)30-29-17-5-2-14(3-6-17)27(34)35/h1-13,33H,28H2,(H,34,35)(H,36,37,38)(H,39,40,41)/b30-29+,32-31+ |
| InChIKey | WLSNRJFSRKGUCY-PNBBGTCESA-N |
| XLogP | 6.30 |
| TPSA | 241.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.61 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|