C28H19N5O11S2 — CID 135827511
8-[(7-amino-1-hydroxy-3-sulfonaphthalen-2-yl)diazenyl]-5-[(2-carboxy-4-sulfophenyl)diazenyl]naphthalene-2-carboxylic acid (PubChem CID 135827511) has the molecular formula C28H19N5O11S2 and a molecular weight of 665.62 g/mol. Its IUPAC name is 8-[(7-amino-1-hydroxy-3-sulfonaphthalen-2-yl)diazenyl]-5-[(2-carboxy-4-sulfophenyl)diazenyl]naphthalene-2-carboxylic acid.
| Compound Name | 8-[(7-amino-1-hydroxy-3-sulfonaphthalen-2-yl)diazenyl]-5-[(2-carboxy-4-sulfophenyl)diazenyl]naphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 135827511 |
| Molecular Formula | C28H19N5O11S2 |
| Molecular Weight | 665.62 g/mol |
| Exact Mass | 665.05 |
| IUPAC Name | 8-[(7-amino-1-hydroxy-3-sulfonaphthalen-2-yl)diazenyl]-5-[(2-carboxy-4-sulfophenyl)diazenyl]naphthalene-2-carboxylic acid |
| SMILES | Nc1ccc2cc(S(=O)(=O)O)c(/N=N/c3ccc(/N=N/c4ccc(S(=O)(=O)O)cc4C(=O)O)c4ccc(C(=O)O)cc34)c(O)c2c1 |
| InChI | InChI=1S/C28H19N5O11S2/c29-15-3-1-13-10-24(46(42,43)44)25(26(34)18(13)11-15)33-32-22-8-7-21(17-5-2-14(27(35)36)9-19(17)22)30-31-23-6-4-16(45(39,40)41)12-20(23)28(37)38/h1-12,34H,29H2,(H,35,36)(H,37,38)(H,39,40,41)(H,42,43,44)/b31-30+,33-32+ |
| InChIKey | NPCNOYZIKKASRF-CJQWSLHQSA-N |
| XLogP | 6.00 |
| TPSA | 279.03 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.62 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|