C24H16N4O14S3 — CID 136640610
5-[(2-carboxy-5-sulfophenyl)diazenyl]-2-[(1-hydroxy-3,6-disulfonaphthalen-2-yl)diazenyl]benzoic acid (PubChem CID 136640610) has the molecular formula C24H16N4O14S3 and a molecular weight of 680.61 g/mol. Its IUPAC name is 5-[(2-carboxy-5-sulfophenyl)diazenyl]-2-[(1-hydroxy-3,6-disulfonaphthalen-2-yl)diazenyl]benzoic acid.
| Compound Name | 5-[(2-carboxy-5-sulfophenyl)diazenyl]-2-[(1-hydroxy-3,6-disulfonaphthalen-2-yl)diazenyl]benzoic acid |
|---|---|
| PubChem CID | 136640610 |
| Molecular Formula | C24H16N4O14S3 |
| Molecular Weight | 680.61 g/mol |
| Exact Mass | 679.98 |
| IUPAC Name | 5-[(2-carboxy-5-sulfophenyl)diazenyl]-2-[(1-hydroxy-3,6-disulfonaphthalen-2-yl)diazenyl]benzoic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)O)cc1/N=N/c1ccc(/N=N/c2c(S(=O)(=O)O)cc3cc(S(=O)(=O)O)ccc3c2O)c(C(=O)O)c1 |
| InChI | InChI=1S/C24H16N4O14S3/c29-22-15-4-2-13(43(34,35)36)7-11(15)8-20(45(40,41)42)21(22)28-26-18-6-1-12(9-17(18)24(32)33)25-27-19-10-14(44(37,38)39)3-5-16(19)23(30)31/h1-10,29H,(H,30,31)(H,32,33)(H,34,35,36)(H,37,38,39)(H,40,41,42)/b27-25+,28-26+ |
| InChIKey | KXMIJPBVLYXCJX-NBHCHVEOSA-N |
| XLogP | 4.51 |
| TPSA | 307.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.61 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|