C30H23N5Na2O8S2 — CID 170843193
CID 170843193 (PubChem CID 170843193) has the molecular formula C30H23N5Na2O8S2 and a molecular weight of 691.66 g/mol.
| Compound Name | CID 170843193 |
|---|---|
| PubChem CID | 170843193 |
| Molecular Formula | C30H23N5Na2O8S2 |
| Molecular Weight | 691.66 g/mol |
| Exact Mass | 691.08 |
| IUPAC Name | — |
| SMILES | Cc1cc(/N=N/c2ccc(S(=O)(=O)O)cc2)ccc1/N=N/c1c(S(=O)(=O)O)cc2cc(NC(=O)c3ccccc3)ccc2c1O.[Na].[Na] |
| InChI | InChI=1S/C30H23N5O8S2.2Na/c1-18-15-23(33-32-21-7-11-24(12-8-21)44(38,39)40)10-14-26(18)34-35-28-27(45(41,42)43)17-20-16-22(9-13-25(20)29(28)36)31-30(37)19-5-3-2-4-6-19;;/h2-17,36H,1H3,(H,31,37)(H,38,39,40)(H,41,42,43);;/b33-32+,35-34+;; |
| InChIKey | TVRRCMSUDOVSMB-NDRCTJIESA-N |
| XLogP | 6.67 |
| TPSA | 207.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.66 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|