C31H25N5O8S2 — CID 136775141
7-benzamido-4-hydroxy-3-[[2-methyl-4-[(2-methyl-4-sulfophenyl)diazenyl]phenyl]diazenyl]naphthalene-2-sulfonic acid (PubChem CID 136775141) has the molecular formula C31H25N5O8S2 and a molecular weight of 659.70 g/mol. Its IUPAC name is 7-benzamido-4-hydroxy-3-[[2-methyl-4-[(2-methyl-4-sulfophenyl)diazenyl]phenyl]diazenyl]naphthalene-2-sulfonic acid.
| Compound Name | 7-benzamido-4-hydroxy-3-[[2-methyl-4-[(2-methyl-4-sulfophenyl)diazenyl]phenyl]diazenyl]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 136775141 |
| Molecular Formula | C31H25N5O8S2 |
| Molecular Weight | 659.70 g/mol |
| Exact Mass | 659.11 |
| IUPAC Name | 7-benzamido-4-hydroxy-3-[[2-methyl-4-[(2-methyl-4-sulfophenyl)diazenyl]phenyl]diazenyl]naphthalene-2-sulfonic acid |
| SMILES | Cc1cc(S(=O)(=O)O)ccc1/N=N/c1ccc(/N=N/c2c(S(=O)(=O)O)cc3cc(NC(=O)c4ccccc4)ccc3c2O)c(C)c1 |
| InChI | InChI=1S/C31H25N5O8S2/c1-18-14-23(33-34-27-13-10-24(15-19(27)2)45(39,40)41)9-12-26(18)35-36-29-28(46(42,43)44)17-21-16-22(8-11-25(21)30(29)37)32-31(38)20-6-4-3-5-7-20/h3-17,37H,1-2H3,(H,32,38)(H,39,40,41)(H,42,43,44)/b34-33+,36-35+ |
| InChIKey | VERSUTMZVJCXJN-WXBFSDFVSA-N |
| XLogP | 7.74 |
| TPSA | 207.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.70 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|