C38H32N8O5S — CID 143799559
7-[(4-aminobenzoyl)amino]-3-[[2,5-dimethyl-4-[[4-[(4-methylphenyl)diazenyl]phenyl]diazenyl]phenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonic acid (PubChem CID 143799559) has the molecular formula C38H32N8O5S and a molecular weight of 712.79 g/mol. Its IUPAC name is 7-[(4-aminobenzoyl)amino]-3-[[2,5-dimethyl-4-[[4-[(4-methylphenyl)diazenyl]phenyl]diazenyl]phenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonic acid.
| Compound Name | 7-[(4-aminobenzoyl)amino]-3-[[2,5-dimethyl-4-[[4-[(4-methylphenyl)diazenyl]phenyl]diazenyl]phenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 143799559 |
| Molecular Formula | C38H32N8O5S |
| Molecular Weight | 712.79 g/mol |
| Exact Mass | 712.22 |
| IUPAC Name | 7-[(4-aminobenzoyl)amino]-3-[[2,5-dimethyl-4-[[4-[(4-methylphenyl)diazenyl]phenyl]diazenyl]phenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonic acid |
| SMILES | Cc1ccc(/N=N/c2ccc(/N=N/c3cc(C)c(/N=N/c4c(S(=O)(=O)O)cc5cc(NC(=O)c6ccc(N)cc6)ccc5c4O)cc3C)cc2)cc1 |
| InChI | InChI=1S/C38H32N8O5S/c1-22-4-10-28(11-5-22)41-42-29-12-14-30(15-13-29)43-44-33-18-24(3)34(19-23(33)2)45-46-36-35(52(49,50)51)21-26-20-31(16-17-32(26)37(36)47)40-38(48)25-6-8-27(39)9-7-25/h4-21,47H,39H2,1-3H3,(H,40,48)(H,49,50,51)/b42-41+,44-43+,46-45+ |
| InChIKey | KPSYYEBYSHQSOQ-NOGTXXKZSA-N |
| XLogP | 10.80 |
| TPSA | 203.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.79 |
| LogP ≤ 5 | 10.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|