C25H21N4NaO6S — CID 135666463
sodium 7-[(4-aminobenzoyl)amino]-4-hydroxy-3-[(2-methoxy-5-methylphenyl)diazenyl]naphthalene-2-sulfonate (PubChem CID 135666463) has the molecular formula C25H21N4NaO6S and a molecular weight of 528.52 g/mol. Its IUPAC name is sodium 7-[(4-aminobenzoyl)amino]-4-hydroxy-3-[(2-methoxy-5-methylphenyl)diazenyl]naphthalene-2-sulfonate.
| Compound Name | sodium 7-[(4-aminobenzoyl)amino]-4-hydroxy-3-[(2-methoxy-5-methylphenyl)diazenyl]naphthalene-2-sulfonate |
|---|---|
| PubChem CID | 135666463 |
| Molecular Formula | C25H21N4NaO6S |
| Molecular Weight | 528.52 g/mol |
| Exact Mass | 528.11 |
| IUPAC Name | sodium 7-[(4-aminobenzoyl)amino]-4-hydroxy-3-[(2-methoxy-5-methylphenyl)diazenyl]naphthalene-2-sulfonate |
| SMILES | COc1ccc(C)cc1/N=N/c1c(S(=O)(=O)[O-])cc2cc(NC(=O)c3ccc(N)cc3)ccc2c1O.[Na+] |
| InChI | InChI=1S/C25H22N4O6S.Na/c1-14-3-10-21(35-2)20(11-14)28-29-23-22(36(32,33)34)13-16-12-18(8-9-19(16)24(23)30)27-25(31)15-4-6-17(26)7-5-15;/h3-13,30H,26H2,1-2H3,(H,27,31)(H,32,33,34);/q;+1/p-1/b29-28+; |
| InChIKey | QCYZVSHSTMEGIC-IRWWKPKRSA-M |
| XLogP | 2.02 |
| TPSA | 166.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.52 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|