C33H30N6O9S2 — CID 137200653
7-[(4-aminobenzoyl)amino]-3-[[4-[(2,4-dimethyl-6-sulfophenyl)diazenyl]-2-methoxy-5-methylphenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonic acid (PubChem CID 137200653) has the molecular formula C33H30N6O9S2 and a molecular weight of 718.77 g/mol. Its IUPAC name is 7-[(4-aminobenzoyl)amino]-3-[[4-[(2,4-dimethyl-6-sulfophenyl)diazenyl]-2-methoxy-5-methylphenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonic acid.
| Compound Name | 7-[(4-aminobenzoyl)amino]-3-[[4-[(2,4-dimethyl-6-sulfophenyl)diazenyl]-2-methoxy-5-methylphenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 137200653 |
| Molecular Formula | C33H30N6O9S2 |
| Molecular Weight | 718.77 g/mol |
| Exact Mass | 718.15 |
| IUPAC Name | 7-[(4-aminobenzoyl)amino]-3-[[4-[(2,4-dimethyl-6-sulfophenyl)diazenyl]-2-methoxy-5-methylphenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonic acid |
| SMILES | COc1cc(/N=N/c2c(C)cc(C)cc2S(=O)(=O)O)c(C)cc1/N=N/c1c(S(=O)(=O)O)cc2cc(NC(=O)c3ccc(N)cc3)ccc2c1O |
| InChI | InChI=1S/C33H30N6O9S2/c1-17-11-19(3)30(28(12-17)49(42,43)44)38-36-25-16-27(48-4)26(13-18(25)2)37-39-31-29(50(45,46)47)15-21-14-23(9-10-24(21)32(31)40)35-33(41)20-5-7-22(34)8-6-20/h5-16,40H,34H2,1-4H3,(H,35,41)(H,42,43,44)(H,45,46,47)/b38-36+,39-37+ |
| InChIKey | KYFGTTWMWDYCAK-NFSGFYSESA-N |
| XLogP | 7.64 |
| TPSA | 242.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.77 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|