C41H31N7NaO9S2+ — CID 135422260
sodium 7-[[4-[[4-[(4-aminobenzoyl)amino]benzoyl]amino]-2-methylphenyl]diazenyl]-4-hydroxy-3-[(6-sulfonaphthalen-2-yl)diazenyl]naphthalene-2-sulfonic acid (PubChem CID 135422260) has the molecular formula C41H31N7NaO9S2+ and a molecular weight of 852.86 g/mol. Its IUPAC name is sodium 7-[[4-[[4-[(4-aminobenzoyl)amino]benzoyl]amino]-2-methylphenyl]diazenyl]-4-hydroxy-3-[(6-sulfonaphthalen-2-yl)diazenyl]naphthalene-2-sulfonic acid.
| Compound Name | sodium 7-[[4-[[4-[(4-aminobenzoyl)amino]benzoyl]amino]-2-methylphenyl]diazenyl]-4-hydroxy-3-[(6-sulfonaphthalen-2-yl)diazenyl]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 135422260 |
| Molecular Formula | C41H31N7NaO9S2+ |
| Molecular Weight | 852.86 g/mol |
| Exact Mass | 852.15 |
| IUPAC Name | sodium 7-[[4-[[4-[(4-aminobenzoyl)amino]benzoyl]amino]-2-methylphenyl]diazenyl]-4-hydroxy-3-[(6-sulfonaphthalen-2-yl)diazenyl]naphthalene-2-sulfonic acid |
| SMILES | Cc1cc(NC(=O)c2ccc(NC(=O)c3ccc(N)cc3)cc2)ccc1/N=N/c1ccc2c(O)c(/N=N/c3ccc4cc(S(=O)(=O)O)ccc4c3)c(S(=O)(=O)O)cc2c1.[Na+] |
| InChI | InChI=1S/C41H31N7O9S2.Na/c1-23-18-31(44-41(51)25-4-10-30(11-5-25)43-40(50)24-2-8-29(42)9-3-24)14-17-36(23)47-45-33-13-16-35-28(20-33)22-37(59(55,56)57)38(39(35)49)48-46-32-12-6-27-21-34(58(52,53)54)15-7-26(27)19-32;/h2-22,49H,42H2,1H3,(H,43,50)(H,44,51)(H,52,53,54)(H,55,56,57);/q;+1/b47-45+,48-46+; |
| InChIKey | QYMPHUZYXPGQPS-AVMNCDHKSA-N |
| XLogP | 6.42 |
| TPSA | 262.63 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 60 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 852.86 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|