C30H24N6Na2O7S2 — CID 170845603
CID 170845603 (PubChem CID 170845603) has the molecular formula C30H24N6Na2O7S2 and a molecular weight of 690.67 g/mol.
| Compound Name | CID 170845603 |
|---|---|
| PubChem CID | 170845603 |
| Molecular Formula | C30H24N6Na2O7S2 |
| Molecular Weight | 690.67 g/mol |
| Exact Mass | 690.09 |
| IUPAC Name | — |
| SMILES | Cc1cc(NC(=O)c2ccc(N)cc2)ccc1/N=N/c1ccc(/N=N/c2ccc3cc(S(=O)(=O)O)cc(S(=O)(=O)O)c3c2)cc1.[Na].[Na] |
| InChI | InChI=1S/C30H24N6O7S2.2Na/c1-18-14-24(32-30(37)19-2-5-21(31)6-3-19)12-13-28(18)36-34-23-10-8-22(9-11-23)33-35-25-7-4-20-15-26(44(38,39)40)17-29(27(20)16-25)45(41,42)43;;/h2-17H,31H2,1H3,(H,32,37)(H,38,39,40)(H,41,42,43);;/b35-33+,36-34+;; |
| InChIKey | MWSRADCLXSZBFZ-UUIOKUIJSA-N |
| XLogP | 6.55 |
| TPSA | 213.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.67 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|