C18H16N4O6S2 — CID 89321172
7-[[2-methyl-4-(methyldiazenyl)phenyl]diazenyl]naphthalene-1,3-disulfonic acid (PubChem CID 89321172) has the molecular formula C18H16N4O6S2 and a molecular weight of 448.48 g/mol. Its IUPAC name is 7-[[2-methyl-4-(methyldiazenyl)phenyl]diazenyl]naphthalene-1,3-disulfonic acid.
| Compound Name | 7-[[2-methyl-4-(methyldiazenyl)phenyl]diazenyl]naphthalene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 89321172 |
| Molecular Formula | C18H16N4O6S2 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.05 |
| IUPAC Name | 7-[[2-methyl-4-(methyldiazenyl)phenyl]diazenyl]naphthalene-1,3-disulfonic acid |
| SMILES | C/N=N/c1ccc(/N=N/c2ccc3cc(S(=O)(=O)O)cc(S(=O)(=O)O)c3c2)c(C)c1 |
| InChI | InChI=1S/C18H16N4O6S2/c1-11-7-13(20-19-2)5-6-17(11)22-21-14-4-3-12-8-15(29(23,24)25)10-18(16(12)9-14)30(26,27)28/h3-10H,1-2H3,(H,23,24,25)(H,26,27,28)/b20-19+,22-21+ |
| InChIKey | ZSIVFYDJYRSEDL-DKHHWMATSA-N |
| XLogP | 4.77 |
| TPSA | 158.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|