C20H14N2O13S4 — CID 136866266
4-[(6,8-disulfonaphthalen-2-yl)diazenyl]-3-hydroxynaphthalene-2,7-disulfonic acid (PubChem CID 136866266) has the molecular formula C20H14N2O13S4 and a molecular weight of 618.60 g/mol. Its IUPAC name is 4-[(6,8-disulfonaphthalen-2-yl)diazenyl]-3-hydroxynaphthalene-2,7-disulfonic acid.
| Compound Name | 4-[(6,8-disulfonaphthalen-2-yl)diazenyl]-3-hydroxynaphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 136866266 |
| Molecular Formula | C20H14N2O13S4 |
| Molecular Weight | 618.60 g/mol |
| Exact Mass | 617.94 |
| IUPAC Name | 4-[(6,8-disulfonaphthalen-2-yl)diazenyl]-3-hydroxynaphthalene-2,7-disulfonic acid |
| SMILES | O=S(=O)(O)c1cc(S(=O)(=O)O)c2cc(/N=N/c3c(O)c(S(=O)(=O)O)cc4cc(S(=O)(=O)O)ccc34)ccc2c1 |
| InChI | InChI=1S/C20H14N2O13S4/c23-20-18(39(33,34)35)7-11-6-13(36(24,25)26)3-4-15(11)19(20)22-21-12-2-1-10-5-14(37(27,28)29)9-17(16(10)8-12)38(30,31)32/h1-9,23H,(H,24,25,26)(H,27,28,29)(H,30,31,32)(H,33,34,35)/b22-21+ |
| InChIKey | AKWRHZJNANMOMF-QURGRASLSA-N |
| XLogP | 3.10 |
| TPSA | 262.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.60 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|