C20H15N2NaO10S3 — CID 173363893
sodium;hydride;3-hydroxy-4-[(4-sulfonaphthalen-1-yl)diazenyl]naphthalene-2,7-disulfonic acid (PubChem CID 173363893) has the molecular formula C20H15N2NaO10S3 and a molecular weight of 562.54 g/mol. Its IUPAC name is sodium;hydride;3-hydroxy-4-[(4-sulfonaphthalen-1-yl)diazenyl]naphthalene-2,7-disulfonic acid.
| Compound Name | sodium;hydride;3-hydroxy-4-[(4-sulfonaphthalen-1-yl)diazenyl]naphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 173363893 |
| Molecular Formula | C20H15N2NaO10S3 |
| Molecular Weight | 562.54 g/mol |
| Exact Mass | 561.98 |
| IUPAC Name | sodium;hydride;3-hydroxy-4-[(4-sulfonaphthalen-1-yl)diazenyl]naphthalene-2,7-disulfonic acid |
| SMILES | O=S(=O)(O)c1ccc2c(/N=N/c3ccc(S(=O)(=O)O)c4ccccc34)c(O)c(S(=O)(=O)O)cc2c1.[H-].[Na+] |
| InChI | InChI=1S/C20H14N2O10S3.Na.H/c23-20-18(35(30,31)32)10-11-9-12(33(24,25)26)5-6-13(11)19(20)22-21-16-7-8-17(34(27,28)29)15-4-2-1-3-14(15)16;;/h1-10,23H,(H,24,25,26)(H,27,28,29)(H,30,31,32);;/q;+1;-1/b22-21+;; |
| InChIKey | YLVAHLTVGCSZRK-ZPZFBZIMSA-N |
| XLogP | 0.97 |
| TPSA | 208.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.54 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|