C20H12N2O10S3-2 — CID 162315735
3-hydroxy-7-sulfo-4-[(4-sulfonatonaphthalen-1-yl)diazenyl]naphthalene-2-sulfonate (PubChem CID 162315735) has the molecular formula C20H12N2O10S3-2 and a molecular weight of 536.52 g/mol. Its IUPAC name is 3-hydroxy-7-sulfo-4-[(4-sulfonatonaphthalen-1-yl)diazenyl]naphthalene-2-sulfonate.
| Compound Name | 3-hydroxy-7-sulfo-4-[(4-sulfonatonaphthalen-1-yl)diazenyl]naphthalene-2-sulfonate |
|---|---|
| PubChem CID | 162315735 |
| Molecular Formula | C20H12N2O10S3-2 |
| Molecular Weight | 536.52 g/mol |
| Exact Mass | 535.97 |
| IUPAC Name | 3-hydroxy-7-sulfo-4-[(4-sulfonatonaphthalen-1-yl)diazenyl]naphthalene-2-sulfonate |
| SMILES | O=S(=O)([O-])c1cc2cc(S(=O)(=O)O)ccc2c(/N=N/c2ccc(S(=O)(=O)[O-])c3ccccc23)c1O |
| InChI | InChI=1S/C20H14N2O10S3/c23-20-18(35(30,31)32)10-11-9-12(33(24,25)26)5-6-13(11)19(20)22-21-16-7-8-17(34(27,28)29)15-4-2-1-3-14(15)16/h1-10,23H,(H,24,25,26)(H,27,28,29)(H,30,31,32)/p-2/b22-21+ |
| InChIKey | IRPXADUBAQAOKL-QURGRASLSA-L |
| XLogP | 3.17 |
| TPSA | 213.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.52 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|