C17H11N2NaO9S2 — CID 136502137
sodium 5-[(2-carboxyphenyl)diazenyl]-6-hydroxy-7-sulfonaphthalene-2-sulfonate (PubChem CID 136502137) has the molecular formula C17H11N2NaO9S2 and a molecular weight of 474.40 g/mol. Its IUPAC name is sodium 5-[(2-carboxyphenyl)diazenyl]-6-hydroxy-7-sulfonaphthalene-2-sulfonate.
| Compound Name | sodium 5-[(2-carboxyphenyl)diazenyl]-6-hydroxy-7-sulfonaphthalene-2-sulfonate |
|---|---|
| PubChem CID | 136502137 |
| Molecular Formula | C17H11N2NaO9S2 |
| Molecular Weight | 474.40 g/mol |
| Exact Mass | 473.98 |
| IUPAC Name | sodium 5-[(2-carboxyphenyl)diazenyl]-6-hydroxy-7-sulfonaphthalene-2-sulfonate |
| SMILES | O=C(O)c1ccccc1/N=N/c1c(O)c(S(=O)(=O)O)cc2cc(S(=O)(=O)[O-])ccc12.[Na+] |
| InChI | InChI=1S/C17H12N2O9S2.Na/c20-16-14(30(26,27)28)8-9-7-10(29(23,24)25)5-6-11(9)15(16)19-18-13-4-2-1-3-12(13)17(21)22;/h1-8,20H,(H,21,22)(H,23,24,25)(H,26,27,28);/q;+1/p-1/b19-18+; |
| InChIKey | QUWBMHATQKBBOD-LTRPLHCISA-M |
| XLogP | -0.19 |
| TPSA | 193.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.40 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|