C17H9N2Na2O9S2- — CID 136731002
disodium;3-[(2-carboxyphenyl)diazenyl]-4-oxidonaphthalene-2,7-disulfonate (PubChem CID 136731002) has the molecular formula C17H9N2Na2O9S2- and a molecular weight of 495.38 g/mol. Its IUPAC name is disodium;3-[(2-carboxyphenyl)diazenyl]-4-oxidonaphthalene-2,7-disulfonate.
| Compound Name | disodium;3-[(2-carboxyphenyl)diazenyl]-4-oxidonaphthalene-2,7-disulfonate |
|---|---|
| PubChem CID | 136731002 |
| Molecular Formula | C17H9N2Na2O9S2- |
| Molecular Weight | 495.38 g/mol |
| Exact Mass | 494.96 |
| IUPAC Name | disodium;3-[(2-carboxyphenyl)diazenyl]-4-oxidonaphthalene-2,7-disulfonate |
| SMILES | O=C(O)c1ccccc1/N=N/c1c(S(=O)(=O)[O-])cc2cc(S(=O)(=O)[O-])ccc2c1[O-].[Na+].[Na+] |
| InChI | InChI=1S/C17H12N2O9S2.2Na/c20-16-11-6-5-10(29(23,24)25)7-9(11)8-14(30(26,27)28)15(16)19-18-13-4-2-1-3-12(13)17(21)22;;/h1-8,20H,(H,21,22)(H,23,24,25)(H,26,27,28);;/q;2*+1/p-3/b19-18+;; |
| InChIKey | IZDCCRPVCGQRHJ-BUFQOAPZSA-K |
| XLogP | -4.16 |
| TPSA | 199.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.38 |
| LogP ≤ 5 | -4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|