C16H11N2NaO7S2 — CID 136682992
sodium 6-hydroxy-5-[(2-sulfophenyl)diazenyl]naphthalene-2-sulfonate (PubChem CID 136682992) has the molecular formula C16H11N2NaO7S2 and a molecular weight of 430.40 g/mol. Its IUPAC name is sodium 6-hydroxy-5-[(2-sulfophenyl)diazenyl]naphthalene-2-sulfonate.
| Compound Name | sodium 6-hydroxy-5-[(2-sulfophenyl)diazenyl]naphthalene-2-sulfonate |
|---|---|
| PubChem CID | 136682992 |
| Molecular Formula | C16H11N2NaO7S2 |
| Molecular Weight | 430.40 g/mol |
| Exact Mass | 429.99 |
| IUPAC Name | sodium 6-hydroxy-5-[(2-sulfophenyl)diazenyl]naphthalene-2-sulfonate |
| SMILES | O=S(=O)([O-])c1ccc2c(/N=N/c3ccccc3S(=O)(=O)O)c(O)ccc2c1.[Na+] |
| InChI | InChI=1S/C16H12N2O7S2.Na/c19-14-8-5-10-9-11(26(20,21)22)6-7-12(10)16(14)18-17-13-3-1-2-4-15(13)27(23,24)25;/h1-9,19H,(H,20,21,22)(H,23,24,25);/q;+1/p-1/b18-17+; |
| InChIKey | FTYXFRXWXVINPV-ZAGWXBKKSA-M |
| XLogP | 0.12 |
| TPSA | 156.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.40 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|