C26H18N4O7S2 — CID 137281246
6-hydroxy-5-[[4-[(2-sulfophenyl)diazenyl]naphthalen-1-yl]diazenyl]naphthalene-2-sulfonic acid (PubChem CID 137281246) has the molecular formula C26H18N4O7S2 and a molecular weight of 562.59 g/mol. Its IUPAC name is 6-hydroxy-5-[[4-[(2-sulfophenyl)diazenyl]naphthalen-1-yl]diazenyl]naphthalene-2-sulfonic acid.
| Compound Name | 6-hydroxy-5-[[4-[(2-sulfophenyl)diazenyl]naphthalen-1-yl]diazenyl]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 137281246 |
| Molecular Formula | C26H18N4O7S2 |
| Molecular Weight | 562.59 g/mol |
| Exact Mass | 562.06 |
| IUPAC Name | 6-hydroxy-5-[[4-[(2-sulfophenyl)diazenyl]naphthalen-1-yl]diazenyl]naphthalene-2-sulfonic acid |
| SMILES | O=S(=O)(O)c1ccc2c(/N=N/c3ccc(/N=N/c4ccccc4S(=O)(=O)O)c4ccccc34)c(O)ccc2c1 |
| InChI | InChI=1S/C26H18N4O7S2/c31-24-14-9-16-15-17(38(32,33)34)10-11-18(16)26(24)30-28-22-13-12-21(19-5-1-2-6-20(19)22)27-29-23-7-3-4-8-25(23)39(35,36)37/h1-15,31H,(H,32,33,34)(H,35,36,37)/b29-27+,30-28+ |
| InChIKey | DUKFICSSCRNYFD-QAVVBOBSSA-N |
| XLogP | 7.02 |
| TPSA | 178.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.59 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|