C17H14N2NaO5S+ — CID 135421994
sodium 6-hydroxy-5-[(2-methoxyphenyl)diazenyl]naphthalene-2-sulfonic acid (PubChem CID 135421994) has the molecular formula C17H14N2NaO5S+ and a molecular weight of 381.37 g/mol. Its IUPAC name is sodium 6-hydroxy-5-[(2-methoxyphenyl)diazenyl]naphthalene-2-sulfonic acid.
| Compound Name | sodium 6-hydroxy-5-[(2-methoxyphenyl)diazenyl]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 135421994 |
| Molecular Formula | C17H14N2NaO5S+ |
| Molecular Weight | 381.37 g/mol |
| Exact Mass | 381.05 |
| IUPAC Name | sodium 6-hydroxy-5-[(2-methoxyphenyl)diazenyl]naphthalene-2-sulfonic acid |
| SMILES | COc1ccccc1/N=N/c1c(O)ccc2cc(S(=O)(=O)O)ccc12.[Na+] |
| InChI | InChI=1S/C17H14N2O5S.Na/c1-24-16-5-3-2-4-14(16)18-19-17-13-8-7-12(25(21,22)23)10-11(13)6-9-15(17)20;/h2-10,20H,1H3,(H,21,22,23);/q;+1/b19-18+; |
| InChIKey | HHQQZJKABYRTCE-LTRPLHCISA-N |
| XLogP | 1.22 |
| TPSA | 108.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.37 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|