C18H16N2NaO8S2 — CID 156592243
CID 156592243 (PubChem CID 156592243) has the molecular formula C18H16N2NaO8S2 and a molecular weight of 475.46 g/mol.
| Compound Name | CID 156592243 |
|---|---|
| PubChem CID | 156592243 |
| Molecular Formula | C18H16N2NaO8S2 |
| Molecular Weight | 475.46 g/mol |
| Exact Mass | 475.02 |
| IUPAC Name | — |
| SMILES | COc1cc(S(=O)(=O)O)c(C)cc1/N=N/c1c(O)ccc2cc(S(=O)(=O)O)ccc12.[Na] |
| InChI | InChI=1S/C18H16N2O8S2.Na/c1-10-7-14(16(28-2)9-17(10)30(25,26)27)19-20-18-13-5-4-12(29(22,23)24)8-11(13)3-6-15(18)21;/h3-9,21H,1-2H3,(H,22,23,24)(H,25,26,27);/b20-19+; |
| InChIKey | DZYBEOXTUJOKAP-RZLHGTIFSA-N |
| XLogP | 3.39 |
| TPSA | 162.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.46 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|