C14H14N2O7S2 — CID 89359765
4-methoxy-2-methyl-5-[(4-sulfophenyl)diazenyl]benzenesulfonic acid (PubChem CID 89359765) has the molecular formula C14H14N2O7S2 and a molecular weight of 386.41 g/mol. Its IUPAC name is 4-methoxy-2-methyl-5-[(4-sulfophenyl)diazenyl]benzenesulfonic acid.
| Compound Name | 4-methoxy-2-methyl-5-[(4-sulfophenyl)diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 89359765 |
| Molecular Formula | C14H14N2O7S2 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.02 |
| IUPAC Name | 4-methoxy-2-methyl-5-[(4-sulfophenyl)diazenyl]benzenesulfonic acid |
| SMILES | COc1cc(C)c(S(=O)(=O)O)cc1/N=N/c1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C14H14N2O7S2/c1-9-7-13(23-2)12(8-14(9)25(20,21)22)16-15-10-3-5-11(6-4-10)24(17,18)19/h3-8H,1-2H3,(H,17,18,19)(H,20,21,22)/b16-15+ |
| InChIKey | QFQHRDMNTVPFAM-FOCLMDBBSA-N |
| XLogP | 2.91 |
| TPSA | 142.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|