C20H18LiN4O5S — CID 170841644
CID 170841644 (PubChem CID 170841644) has the molecular formula C20H18LiN4O5S and a molecular weight of 433.40 g/mol.
| Compound Name | CID 170841644 |
|---|---|
| PubChem CID | 170841644 |
| Molecular Formula | C20H18LiN4O5S |
| Molecular Weight | 433.40 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | — |
| SMILES | COc1cc(/N=N/c2cccc(S(=O)(=O)O)c2)ccc1/N=N/c1ccc(O)c(C)c1.[Li] |
| InChI | InChI=1S/C20H18N4O5S.Li/c1-13-10-15(7-9-19(13)25)23-24-18-8-6-16(12-20(18)29-2)22-21-14-4-3-5-17(11-14)30(26,27)28;/h3-12,25H,1-2H3,(H,26,27,28);/b22-21+,24-23+; |
| InChIKey | PRTAQLMEWJPIPY-HQHRKKNHSA-N |
| XLogP | 5.41 |
| TPSA | 133.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.40 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|