C23H18N4NaO8S2+ — CID 135422209
sodium 5-hydroxy-6-[[2-methoxy-4-[(4-sulfophenyl)diazenyl]phenyl]diazenyl]naphthalene-1-sulfonic acid (PubChem CID 135422209) has the molecular formula C23H18N4NaO8S2+ and a molecular weight of 565.54 g/mol. Its IUPAC name is sodium 5-hydroxy-6-[[2-methoxy-4-[(4-sulfophenyl)diazenyl]phenyl]diazenyl]naphthalene-1-sulfonic acid.
| Compound Name | sodium 5-hydroxy-6-[[2-methoxy-4-[(4-sulfophenyl)diazenyl]phenyl]diazenyl]naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 135422209 |
| Molecular Formula | C23H18N4NaO8S2+ |
| Molecular Weight | 565.54 g/mol |
| Exact Mass | 565.05 |
| IUPAC Name | sodium 5-hydroxy-6-[[2-methoxy-4-[(4-sulfophenyl)diazenyl]phenyl]diazenyl]naphthalene-1-sulfonic acid |
| SMILES | COc1cc(/N=N/c2ccc(S(=O)(=O)O)cc2)ccc1/N=N/c1ccc2c(S(=O)(=O)O)cccc2c1O.[Na+] |
| InChI | InChI=1S/C23H18N4O8S2.Na/c1-35-21-13-15(25-24-14-5-8-16(9-6-14)36(29,30)31)7-11-19(21)26-27-20-12-10-17-18(23(20)28)3-2-4-22(17)37(32,33)34;/h2-13,28H,1H3,(H,29,30,31)(H,32,33,34);/q;+1/b25-24+,27-26+; |
| InChIKey | AYYDELQZNZANQJ-ZZFYGNPESA-N |
| XLogP | 2.88 |
| TPSA | 187.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.54 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|